Triton X-100



CASR:9002-93-1
Molecular Formula:C14H21-[C2H4O]10-OH
Molecular Weight:646.87

Select Grade:
Specifications