Brucine sulphate



CASR:5787-00-8
Molecular Formula:(C23H26N2O4)2.H2SO4.7H2O
Molecular Weight:1013.12

Select Grade:
Specifications